Compound Q&A

What industries use 2-Naphthyl diphenyl phosphate (CAS: 18872-49-6)?

Answer

2-Naphthyl diphenyl phosphate
2-Naphthyl diphenyl phosphate (CAS: 18872-49-6) is used in various industries, including pharmaceuticals for its anti-inflammatory and analgesic properties, and also in the polymer industry as an additive for flame retardancy and heat stabilization. It is also explored in the development of sensors and semiconductors for its unique chemical and physical properties.

About

CAS No 18872-49-6
English Name 2-Naphthyl diphenyl phosphate
Molecular Formula C22H17O4P
Molecular Weight 376.35 g/mol
SMILES C1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC4=CC=CC=C4C=C3
InChIKey JSJUBNHZCFKUKY-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Naphthyl diphenyl phosphate (CAS: 18872-49-6)?

2-Naphthyl diphenyl phosphate (CAS: 18872-49-6) is a crystalline compound with a molecular weight of...

Compound Q&A

How is 2-Naphthyl diphenyl phosphate (CAS: 18872-49-6) typically synthesized?

2-Naphthyl diphenyl phosphate is typically synthesized by the reaction of naphthalene with phosphoru...

Compound Q&A

What precautions should be taken when handling 2-Naphthyl diphenyl phosphate (CAS: 18872-49-6)?

When handling 2-Naphthyl diphenyl phosphate (CAS: 18872-49-6), it is essential to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...