Compound Q&A

What are the physical and chemical properties of 2-Naphthyl diphenyl phosphate (CAS: 18872-49-6)?

Answer

2-Naphthyl diphenyl phosphate
2-Naphthyl diphenyl phosphate (CAS: 18872-49-6) is a crystalline compound with a molecular weight of approximately 406.33 g/mol. It has a high solubility in organic solvents like benzene and toluene but is poorly soluble in water. Chemically, it is relatively stable but can react with strong bases. It has a melting point of about 120-125°C and is insoluble in water.

About

CAS No 18872-49-6
English Name 2-Naphthyl diphenyl phosphate
Molecular Formula C22H17O4P
Molecular Weight 376.35 g/mol
SMILES C1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC4=CC=CC=C4C=C3
InChIKey JSJUBNHZCFKUKY-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is 2-Naphthyl diphenyl phosphate (CAS: 18872-49-6) typically synthesized?

2-Naphthyl diphenyl phosphate is typically synthesized by the reaction of naphthalene with phosphoru...

Compound Q&A

What industries use 2-Naphthyl diphenyl phosphate (CAS: 18872-49-6)?

2-Naphthyl diphenyl phosphate (CAS: 18872-49-6) is used in various industries, including pharmaceuti...

Compound Q&A

What precautions should be taken when handling 2-Naphthyl diphenyl phosphate (CAS: 18872-49-6)?

When handling 2-Naphthyl diphenyl phosphate (CAS: 18872-49-6), it is essential to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...