Compound Q&A

How is Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8) typically synthesized?

Answer

Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate
Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8) is typically synthesized through the esterification of benzenetricarboxylic acid with 8-methylnonanol in the presence of a catalyst such as p-toluenesulfonic acid. The reaction involves the formation of an ester through a condensation reaction, yielding a product with a high yield and good selectivity.

About

CAS No 36631-30-8
English Name Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate
Molecular Formula C39H66O6
Molecular Weight 630.95 g/mol
SMILES CC(C)CCCCCCCOC(=O)C1=CC(=C(C=C1)C(=O)OCCCCCCCC(C)C)C(=O)OCCCCCCCC(C)C
InChIKey FJFYFBRNDHRTHL-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8)?

Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8) is a crystalline compound with a m...

Compound Q&A

What industries use Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8)?

Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8) is used in various industries, inc...

Compound Q&A

What precautions should be taken when handling Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8)?

When handling Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8), it is important to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...