Compound Q&A

What are the physical and chemical properties of Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8)?

Answer

Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate
Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8) is a crystalline compound with a molecular weight of approximately 480 g/mol. It has a high melting point and is poorly soluble in water but soluble in organic solvents like ethanol and acetone. The compound exhibits moderate reactivity, particularly in esterification reactions, and is stable under normal conditions.

About

CAS No 36631-30-8
English Name Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate
Molecular Formula C39H66O6
Molecular Weight 630.95 g/mol
SMILES CC(C)CCCCCCCOC(=O)C1=CC(=C(C=C1)C(=O)OCCCCCCCC(C)C)C(=O)OCCCCCCCC(C)C
InChIKey FJFYFBRNDHRTHL-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8) typically synthesized?

Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8) is typically synthesized through t...

Compound Q&A

What industries use Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8)?

Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8) is used in various industries, inc...

Compound Q&A

What precautions should be taken when handling Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8)?

When handling Tris(8-methylnonyl) 1,2,4-benzenetricarboxylate (CAS: 36631-30-8), it is important to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...