Compound Q&A

How is (1R)-1-(4-nitrophenyl)ethan-1-ol (CAS: 58287-18-6) typically synthesized?

Answer

(1R)-1-(4-nitrophenyl)ethan-1-ol
(1R)-1-(4-nitrophenyl)ethan-1-ol can be synthesized via a nitration process where 4-nitrophenol is reacted with ethanol in the presence of a suitable acid catalyst such as sulfuric acid. This method provides good yield and selectivity, making it a common approach in the laboratory setting.

About

CAS No 58287-18-6
English Name (1R)-1-(4-nitrophenyl)ethan-1-ol
Molecular Formula C8H9NO3
Molecular Weight 167.16 g/mol
SMILES CC(C1=CC=C(C=C1)[N+](=O)[O-])O
InChIKey CRJFHXYELTYDSG-ZCFIWIBFSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R)-1-(4-nitrophenyl)ethan-1-ol (CAS: 58287-18-6)?

(1R)-1-(4-nitrophenyl)ethan-1-ol is a crystalline solid with a molecular weight of approximately 225...

Compound Q&A

What industries use (1R)-1-(4-nitrophenyl)ethan-1-ol (CAS: 58287-18-6)?

(1R)-1-(4-nitrophenyl)ethan-1-ol finds applications in the pharmaceutical industry as an intermediat...

Compound Q&A

What precautions should be taken when handling (1R)-1-(4-nitrophenyl)ethan-1-ol (CAS: 58287-18-6)?

When handling (1R)-1-(4-nitrophenyl)ethan-1-ol, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...