Compound Q&A

What are the physical and chemical properties of (1R)-1-(4-nitrophenyl)ethan-1-ol (CAS: 58287-18-6)?

Answer

(1R)-1-(4-nitrophenyl)ethan-1-ol
(1R)-1-(4-nitrophenyl)ethan-1-ol is a crystalline solid with a molecular weight of approximately 225.12 g/mol. It has a high solubility in common organic solvents such as ethanol and acetone. This compound is relatively stable but can react with strong bases. It is often used in various organic reactions due to its ability to act as a phenolic group donor.

About

CAS No 58287-18-6
English Name (1R)-1-(4-nitrophenyl)ethan-1-ol
Molecular Formula C8H9NO3
Molecular Weight 167.16 g/mol
SMILES CC(C1=CC=C(C=C1)[N+](=O)[O-])O
InChIKey CRJFHXYELTYDSG-ZCFIWIBFSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is (1R)-1-(4-nitrophenyl)ethan-1-ol (CAS: 58287-18-6) typically synthesized?

(1R)-1-(4-nitrophenyl)ethan-1-ol can be synthesized via a nitration process where 4-nitrophenol is r...

Compound Q&A

What industries use (1R)-1-(4-nitrophenyl)ethan-1-ol (CAS: 58287-18-6)?

(1R)-1-(4-nitrophenyl)ethan-1-ol finds applications in the pharmaceutical industry as an intermediat...

Compound Q&A

What precautions should be taken when handling (1R)-1-(4-nitrophenyl)ethan-1-ol (CAS: 58287-18-6)?

When handling (1R)-1-(4-nitrophenyl)ethan-1-ol, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...