Compound Q&A

How is 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8) typically synthesized?

Answer

5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin
5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin is commonly synthesized via the condensation of a 4-carboxyphenyl diazonium salt with meso-tetrakis(4-pentylphenyl)porphyrin. This process involves the use of a suitable base and is carried out in a solvent such as DMF. The yield is typically high, with selectivity towards the desired product being excellent.

About

CAS No 95051-10-8
English Name 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin
Molecular Formula C45H30N4O2
Molecular Weight 658.76 g/mol
SMILES C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=C(C=C8)C(=O)O)C=C4)C9=CC=CC=C9)N3
InChIKey GZTMFXHPFNRUNU-LWQDQPMZSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8)?

5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8) is a crystalline compound with a m...

Compound Q&A

What industries use 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8)?

5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8) is used in various industries for ...

Compound Q&A

What precautions should be taken when handling 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8)?

When handling 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8), ensure the use of p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...