Compound Q&A

What are the physical and chemical properties of 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8)?

Answer

5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin
5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8) is a crystalline compound with a molecular weight of approximately 966.31 g/mol. It has limited solubility in common organic solvents like dimethyl sulfoxide (DMSO) and is less soluble in water. The compound exhibits strong reactivity towards metal ions, particularly iron, and can be used as a sensing and catalytic material.

About

CAS No 95051-10-8
English Name 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin
Molecular Formula C45H30N4O2
Molecular Weight 658.76 g/mol
SMILES C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=C(C=C8)C(=O)O)C=C4)C9=CC=CC=C9)N3
InChIKey GZTMFXHPFNRUNU-LWQDQPMZSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8) typically synthesized?

5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin is commonly synthesized via the condensation of a 4-...

Compound Q&A

What industries use 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8)?

5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8) is used in various industries for ...

Compound Q&A

What precautions should be taken when handling 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8)?

When handling 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin (CAS: 95051-10-8), ensure the use of p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...