Compound Q&A

What industries use (1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride (CAS: 1314324-00-9)?

Answer

(1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride (1:1)
(1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride is primarily used in the pharmaceutical industry for the development of novel drug candidates due to its unique chemical structure. It may also find applications in the polymer industry for customizing materials with specific properties, and in the semiconductor industry for its potential use in certain dopants.

About

English Name (1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride (1:1)
Molecular Formula C9H11ClFN
Molecular Weight 187.64 g/mol
SMILES N[C@@H]1C[C@H]1c1ccc(cc1)F.Cl
InChIKey ZQPBZLHQLCAFOQ-OULXEKPRSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride (CAS: 1314324-00-9)?

(1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride is a white to off-white crystalline solid w...

Compound Q&A

How is (1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride (CAS: 1314324-00-9) typically synthesized?

(1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride is typically synthesized by a multistep pro...

Compound Q&A

What precautions should be taken when handling (1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride (CAS: 1314324-00-9)?

When handling (1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride, it is important to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...