Compound Q&A

How is (1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride (CAS: 1314324-00-9) typically synthesized?

Answer

(1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride (1:1)
(1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride is typically synthesized by a multistep process involving the formation of the amine via a cyclopropanation reaction, followed by the introduction of the 4-fluorophenyl group and subsequent protonation to form the hydrochloride salt. The yield and selectivity can be optimized using appropriate solvents and catalysts.

About

English Name (1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride (1:1)
Molecular Formula C9H11ClFN
Molecular Weight 187.64 g/mol
SMILES N[C@@H]1C[C@H]1c1ccc(cc1)F.Cl
InChIKey ZQPBZLHQLCAFOQ-OULXEKPRSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride (CAS: 1314324-00-9)?

(1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride is a white to off-white crystalline solid w...

Compound Q&A

What industries use (1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride (CAS: 1314324-00-9)?

(1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling (1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride (CAS: 1314324-00-9)?

When handling (1R,2S)-2-(4-Fluorophenyl)cyclopropanamine hydrochloride, it is important to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...