Compound Q&A

What are the physical and chemical properties of [(1R,5S,6S)-6-(Aminomethyl)-3-ethylbicyclo[3.2.0]hept-3-en-6-yl]acetic acid benzenesulfonate (CAS: 1138245-21-2)?

Answer

[(1R,5S,6S)-6-(Aminomethyl)-3-ethylbicyclo[3.2.0]hept-3-en-6-yl]acetic acid benzenesulfonate (1:1)
The compound [(1R,5S,6S)-6-(Aminomethyl)-3-ethylbicyclo[3.2.0]hept-3-en-6-yl]acetic acid benzenesulfonate is a white crystalline solid with a molecular weight of approximately 411.35 g/mol. It has a pKa around 4.2 and is moderately soluble in water. The compound is reactive towards nucleophiles and can undergo substitution reactions. It also shows moderate stability under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

English Name [(1R,5S,6S)-6-(Aminomethyl)-3-ethylbicyclo[3.2.0]hept-3-en-6-yl]acetic acid benzenesulfonate (1:1)
Molecular Formula C18H25NO5S
Molecular Weight 367.47 g/mol
SMILES CCC1=C[C@@H]2[C@H](C1)C[C@@]2(CC(=O)O)CN.c1ccc(cc1)S(=O)(=O)O
InChIKey OKJXJRVWXYRSAN-TXULWXBWSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

How is [(1R,5S,6S)-6-(Aminomethyl)-3-ethylbicyclo[3.2.0]hept-3-en-6-yl]acetic acid benzenesulfonate (CAS: 1138245-21-2) typically synthesized?

This compound is typically synthesized via a multi-step process involving the condensation of an eth...

Compound Q&A

What industries use [(1R,5S,6S)-6-(Aminomethyl)-3-ethylbicyclo[3.2.0]hept-3-en-6-yl]acetic acid benzenesulfonate (CAS: 1138245-21-2)?

This compound is primarily used in the pharmaceutical industry as a potential intermediate in drug s...

Compound Q&A

What precautions should be taken when handling [(1R,5S,6S)-6-(Aminomethyl)-3-ethylbicyclo[3.2.0]hept-3-en-6-yl]acetic acid benzenesulfonate (CAS: 1138245-21-2)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...