Compound Q&A

What industries use 5-Chloro-2-oxo-3-(2-thienylcarbonyl)-1-indolinecarboxamide (CAS: 120210-48-2)?

Answer

5-Chloro-2-oxo-3-(2-thienylcarbonyl)-1-indolinecarboxamide
5-Chloro-2-oxo-3-(2-thienylcarbonyl)-1-indolinecarboxamide is used in the pharmaceutical industry for the development of certain drugs. It also finds applications in the polymer industry as a precursor for various polymer matrices. Additionally, it is used in the sensors and semiconductors industries for specific chemical sensing and electronic device applications.

About

English Name 5-Chloro-2-oxo-3-(2-thienylcarbonyl)-1-indolinecarboxamide
Molecular Formula C14H9ClN2O3S
Molecular Weight 320.76 g/mol
SMILES C1=CSC(=C1)C(=O)C2=C(N(C3=C2C=C(C=C3)Cl)C(=O)N)O
InChIKey IGPDWKCUDHIIRL-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-2-oxo-3-(2-thienylcarbonyl)-1-indolinecarboxamide (CAS: 120210-48-2)?

5-Chloro-2-oxo-3-(2-thienylcarbonyl)-1-indolinecarboxamide is a crystalline compound with a molecula...

Compound Q&A

How is 5-Chloro-2-oxo-3-(2-thienylcarbonyl)-1-indolinecarboxamide (CAS: 120210-48-2) typically synthesized?

5-Chloro-2-oxo-3-(2-thienylcarbonyl)-1-indolinecarboxamide is typically synthesized through a multi-...

Compound Q&A

What precautions should be taken when handling 5-Chloro-2-oxo-3-(2-thienylcarbonyl)-1-indolinecarboxamide (CAS: 120210-48-2)?

When handling 5-Chloro-2-oxo-3-(2-thienylcarbonyl)-1-indolinecarboxamide, it is important to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...