Compound Q&A

How is Peptide histidine isoleucine (CAS: 96849-38-6) typically synthesized?

Answer

Peptide histidine isoleucine
Peptide histidine isoleucine (CAS: 96849-38-6) is synthesized via solid-phase peptide synthesis (SPPS) using Fmoc chemistry. Commonly, the Fmoc-histidine and Fmoc-isoleucine building blocks are coupled sequentially on a solid support, followed by deprotection and cleavage from the support. Catalytic amounts of HOBt and DIC are used to enhance coupling efficiency and reduce side products.

About

CAS No 96849-38-6
English Name Peptide histidine isoleucine
Molecular Formula C136H216N36O41
Molecular Weight 3011.39 g/mol
SMILES CCC(C)C(C(=O)N)NC(=O)C(CC(C)C)NC(=O)C(CO)NC(=O)C(CCC(=O)O)NC(=O)C(CC(C)C)NC(=O)C(CC1=CC=C(C=C1)O)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(C)NC(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C(CCC(=O)N)NC(=O)CNC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(CO)NC(=O)C(CC2=CC=C(C=C2)O)NC(=O)C(CC(=O)O)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C(CC3=CC=CC=C3)NC(=O)C(C(C)C)NC(=O)CNC(=O)C(CC(=O)O)NC(=O)C(C)NC(=O)C(CC4=CN=CN4)N
InChIKey XMZALCKNICOABK-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Peptide histidine isoleucine (CAS: 96849-38-6)?

Peptide histidine isoleucine (CAS: 96849-38-6) is an amphoteric peptide. It has a molecular weight o...

Compound Q&A

What industries use Peptide histidine isoleucine (CAS: 96849-38-6)?

Peptide histidine isoleucine (CAS: 96849-38-6) is primarily used in the pharmaceutical and biotechno...

Compound Q&A

What precautions should be taken when handling Peptide histidine isoleucine (CAS: 96849-38-6)?

When handling Peptide histidine isoleucine (CAS: 96849-38-6), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...