Compound Q&A

What are the physical and chemical properties of Peptide histidine isoleucine (CAS: 96849-38-6)?

Answer

Peptide histidine isoleucine
Peptide histidine isoleucine (CAS: 96849-38-6) is an amphoteric peptide. It has a molecular weight of approximately 332.4 Da and a pI of 7.6. This compound is soluble in water and slightly soluble in organic solvents. It shows moderate reactivity towards nucleophiles and electrophiles, making it useful in peptide synthesis and biological studies.

About

CAS No 96849-38-6
English Name Peptide histidine isoleucine
Molecular Formula C136H216N36O41
Molecular Weight 3011.39 g/mol
SMILES CCC(C)C(C(=O)N)NC(=O)C(CC(C)C)NC(=O)C(CO)NC(=O)C(CCC(=O)O)NC(=O)C(CC(C)C)NC(=O)C(CC1=CC=C(C=C1)O)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(C)NC(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C(CCC(=O)N)NC(=O)CNC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(CO)NC(=O)C(CC2=CC=C(C=C2)O)NC(=O)C(CC(=O)O)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C(CC3=CC=CC=C3)NC(=O)C(C(C)C)NC(=O)CNC(=O)C(CC(=O)O)NC(=O)C(C)NC(=O)C(CC4=CN=CN4)N
InChIKey XMZALCKNICOABK-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

How is Peptide histidine isoleucine (CAS: 96849-38-6) typically synthesized?

Peptide histidine isoleucine (CAS: 96849-38-6) is synthesized via solid-phase peptide synthesis (SPP...

Compound Q&A

What industries use Peptide histidine isoleucine (CAS: 96849-38-6)?

Peptide histidine isoleucine (CAS: 96849-38-6) is primarily used in the pharmaceutical and biotechno...

Compound Q&A

What precautions should be taken when handling Peptide histidine isoleucine (CAS: 96849-38-6)?

When handling Peptide histidine isoleucine (CAS: 96849-38-6), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...