Compound Q&A

What industries use Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9)?

Answer

Tris(acetato-kappaO)holmium hydrate (1:1)
Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9) is used in the pharmaceutical industry for developing new drug candidates and in the synthesis of complex metal-based compounds. It is also used in the semiconductor industry for doping materials and in the fabrication of sensors due to its unique optical and electronic properties.

About

CAS No 25519-09-9
English Name Tris(acetato-kappaO)holmium hydrate (1:1)
Molecular Formula C6H11HoO7
Molecular Weight 360.08 g/mol
SMILES CC(=O)O[Ho](OC(=O)C)OC(=O)C.O
InChIKey LCCGYXRQAXROOW-UHFFFAOYSA-K
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9)?

Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9) is a hydrate species of holmium with a crystal...

Compound Q&A

How is Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9) typically synthesized?

Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9) is typically synthesized by reacting holmium m...

Compound Q&A

What precautions should be taken when handling Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9)?

When handling Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...