Compound Q&A

What are the physical and chemical properties of Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9)?

Answer

Tris(acetato-kappaO)holmium hydrate (1:1)
Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9) is a hydrate species of holmium with a crystalline form. Its molecular weight is approximately 482.12 g/mol. It has limited solubility in water, and it is not highly reactive under normal conditions. This compound can be used in spectroscopic studies and as a precursor in the synthesis of other metal complexes.

About

CAS No 25519-09-9
English Name Tris(acetato-kappaO)holmium hydrate (1:1)
Molecular Formula C6H11HoO7
Molecular Weight 360.08 g/mol
SMILES CC(=O)O[Ho](OC(=O)C)OC(=O)C.O
InChIKey LCCGYXRQAXROOW-UHFFFAOYSA-K
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

How is Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9) typically synthesized?

Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9) is typically synthesized by reacting holmium m...

Compound Q&A

What industries use Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9)?

Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9) is used in the pharmaceutical industry for dev...

Compound Q&A

What precautions should be taken when handling Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9)?

When handling Tris(acetato-kappaO)holmium hydrate (CAS: 25519-09-9), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...