Compound Q&A

What industries use 2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5)?

Answer

2,5-Dimethyl-4-nitroaniline
2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5) finds applications in the pharmaceutical industry, particularly in the synthesis of certain drugs. It is also used in the production of dyes, pigments, and as an intermediate in the synthesis of some polynuclear compounds. Its use in sensors and semiconductors is also noted, though on a smaller scale.

About

CAS No 3460-29-5
English Name 2,5-Dimethyl-4-nitroaniline
Molecular Formula C8H10N2O2
Molecular Weight 166.18 g/mol
SMILES CC1=CC(=C(C=C1[N+](=O)[O-])C)N
InChIKey PJAGNJQUIUEGKP-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5)?

2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5) is a white crystalline solid with a molecular weight of...

Compound Q&A

How is 2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5) typically synthesized?

2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5) is typically synthesized via nitration of 2,5-dimethyla...

Compound Q&A

What precautions should be taken when handling 2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5)?

When handling 2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...