Compound Q&A

What are the physical and chemical properties of 2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5)?

Answer

2,5-Dimethyl-4-nitroaniline
2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5) is a white crystalline solid with a molecular weight of approximately 176.14 g/mol. It has a pKa of around 8.5 and is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. It is known for its reactivity towards nucleophiles and electrophiles, making it useful in various chemical reactions.

About

CAS No 3460-29-5
English Name 2,5-Dimethyl-4-nitroaniline
Molecular Formula C8H10N2O2
Molecular Weight 166.18 g/mol
SMILES CC1=CC(=C(C=C1[N+](=O)[O-])C)N
InChIKey PJAGNJQUIUEGKP-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

How is 2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5) typically synthesized?

2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5) is typically synthesized via nitration of 2,5-dimethyla...

Compound Q&A

What industries use 2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5)?

2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5) finds applications in the pharmaceutical industry, part...

Compound Q&A

What precautions should be taken when handling 2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5)?

When handling 2,5-Dimethyl-4-nitroaniline (CAS: 3460-29-5), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...