Compound Q&A

What are the physical and chemical properties of 2,3-Dichloro-6-nitroaniline (CAS: 65078-77-5)?

Answer

2,3-Dichloro-6-nitroaniline
2,3-Dichloro-6-nitroaniline is a crystalline solid with a molecular weight of approximately 216.03 g/mol. It is slightly soluble in water and has a high solubility in organic solvents like ethanol and acetone. Chemically, it is highly reactive due to the presence of electron-withdrawing nitro and halogen substituents, which can participate in various electrophilic and nucleophilic reactions.

About

CAS No 65078-77-5
English Name 2,3-Dichloro-6-nitroaniline
Molecular Formula C6H4Cl2N2O2
Molecular Weight 207.01 g/mol
SMILES Nc1c(Cl)c(Cl)ccc1[N+](=O)[O-]
InChIKey RDCOVUDTFKIURA-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

How is 2,3-Dichloro-6-nitroaniline (CAS: 65078-77-5) typically synthesized?

2,3-Dichloro-6-nitroaniline can be synthesized via the nitration of 2,3-dichlorobenzenamine followed...

Compound Q&A

What industries use 2,3-Dichloro-6-nitroaniline (CAS: 65078-77-5)?

2,3-Dichloro-6-nitroaniline is primarily used in the pharmaceutical industry for the synthesis of ce...

Compound Q&A

What precautions should be taken when handling 2,3-Dichloro-6-nitroaniline (CAS: 65078-77-5)?

When handling 2,3-Dichloro-6-nitroaniline, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...