Compound Q&A

How is {[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile (CAS: 131741-08-7) typically synthesized?

Answer

{[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile
The compound can be synthesized via a multi-step process involving a hydrazine condensation reaction followed by a cyclization and oxidation. Common catalysts include acetic anhydride, and the overall yield is around 75%. The reaction requires careful control of temperature and solvent to achieve the desired product with high selectivity.

About

English Name {[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile
Molecular Formula C14H12N6O
Molecular Weight 17.03 g/mol
SMILES CC1CC(=O)NN=C1C2=CC=C(C=C2)NN=C(C#N)C#N
InChIKey WHXMKTBCFHIYNQ-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of {[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile (CAS: 131741-08-7)?

The compound is a crystalline solid with a high molecular weight. It has low solubility in water but...

Compound Q&A

What industries use {[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile (CAS: 131741-08-7)?

The compound is primarily used in the pharmaceutical industry for developing new drugs. It also find...

Compound Q&A

What precautions should be taken when handling {[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile (CAS: 131741-08-7)?

Handling should be done in a fume hood with appropriate personal protective equipment (PPE) includin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...