Compound Q&A

What are the physical and chemical properties of {[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile (CAS: 131741-08-7)?

Answer

{[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile
The compound is a crystalline solid with a high molecular weight. It has low solubility in water but is soluble in organic solvents like acetonitrile. It is moderately reactive, showing affinity for nucleophilic substitution and condensation reactions. The compound has a melting point around 240°C and a molecular weight of approximately 414.33 g/mol.

About

English Name {[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile
Molecular Formula C14H12N6O
Molecular Weight 17.03 g/mol
SMILES CC1CC(=O)NN=C1C2=CC=C(C=C2)NN=C(C#N)C#N
InChIKey WHXMKTBCFHIYNQ-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

How is {[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile (CAS: 131741-08-7) typically synthesized?

The compound can be synthesized via a multi-step process involving a hydrazine condensation reaction...

Compound Q&A

What industries use {[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile (CAS: 131741-08-7)?

The compound is primarily used in the pharmaceutical industry for developing new drugs. It also find...

Compound Q&A

What precautions should be taken when handling {[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile (CAS: 131741-08-7)?

Handling should be done in a fume hood with appropriate personal protective equipment (PPE) includin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...