Compound Q&A

What are the physical and chemical properties of 4-(3-Formylphenoxy)benzonitrile (CAS: 90178-72-6)?

Answer

4-(3-Formylphenoxy)benzonitrile
4-(3-Formylphenoxy)benzonitrile is a white crystalline solid with a molecular weight of 234.19 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. The compound is known for its limited reactivity under normal conditions, but it can undergo condensation and electrophilic aromatic substitution reactions. It is insoluble in acetic acid and slightly soluble in benzene.

About

CAS No 90178-72-6
English Name 4-(3-Formylphenoxy)benzonitrile
Molecular Formula C14H9NO2
Molecular Weight 17.03 g/mol
SMILES C1=CC(=CC(=C1)OC2=CC=C(C=C2)C#N)C=O
InChIKey ZNFFJDNCDHKHEJ-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

How is 4-(3-Formylphenoxy)benzonitrile (CAS: 90178-72-6) typically synthesized?

4-(3-Formylphenoxy)benzonitrile is typically synthesized via the reaction of 4-bromobenzonitrile wit...

Compound Q&A

What industries use 4-(3-Formylphenoxy)benzonitrile (CAS: 90178-72-6)?

4-(3-Formylphenoxy)benzonitrile is used in the pharmaceutical industry for the synthesis of certain ...

Compound Q&A

What precautions should be taken when handling 4-(3-Formylphenoxy)benzonitrile (CAS: 90178-72-6)?

Handling 4-(3-Formylphenoxy)benzonitrile requires appropriate personal protective equipment (PPE) in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...