Compound Q&A

How is 4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid (CAS: 1002339-79-8) typically synthesized?

Answer

4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid
4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid is typically synthesized via a two-step process. First, diphenylacetylene is reacted with phthalic anhydride under controlled conditions to form the intermediate. Then, the intermediate is oxidized to yield the final product. This synthesis involves the use of various reagents and catalysts, and the process requires precise temperature and pressure control to achieve high yield and selectivity.

About

English Name 4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid
Molecular Formula C28H20O4
Molecular Weight 420.46 g/mol
SMILES c1ccc(cc1)/C(=C(/c2ccccc2)\c3ccc(cc3)C(=O)O)/c4ccc(cc4)C(=O)O
InChIKey MTTUYJXPONEHGK-OCEACIFDSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid (CAS: 1002339-79-8)?

4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid, also known as diphenyl vinyl dibenzoate (CAS: ...

Compound Q&A

What industries use 4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid (CAS: 1002339-79-8)?

4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid (CAS: 1002339-79-8) finds applications in vario...

Compound Q&A

What precautions should be taken when handling 4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid (CAS: 1002339-79-8)?

When handling 4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid (CAS: 1002339-79-8), it is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...