Compound Q&A

What are the physical and chemical properties of 4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid (CAS: 1002339-79-8)?

Answer

4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid
4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid, also known as diphenyl vinyl dibenzoate (CAS: 1002339-79-8), is a crystalline compound with a high melting point of around 280°C. Its molecular weight is approximately 458.4 g/mol. The compound is moderately soluble in polar organic solvents like dimethyl sulfoxide (DMSO) and ethyl acetate. Chemically, it shows a high reactivity towards nucleophiles and electrophiles due to its aromatic nature and the presence of electron-withdrawing groups.

About

English Name 4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid
Molecular Formula C28H20O4
Molecular Weight 420.46 g/mol
SMILES c1ccc(cc1)/C(=C(/c2ccccc2)\c3ccc(cc3)C(=O)O)/c4ccc(cc4)C(=O)O
InChIKey MTTUYJXPONEHGK-OCEACIFDSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

How is 4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid (CAS: 1002339-79-8) typically synthesized?

4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid is typically synthesized via a two-step process...

Compound Q&A

What industries use 4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid (CAS: 1002339-79-8)?

4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid (CAS: 1002339-79-8) finds applications in vario...

Compound Q&A

What precautions should be taken when handling 4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid (CAS: 1002339-79-8)?

When handling 4,4'-[(E)-1,2-Diphenyl-1,2-ethenediyl]dibenzoic acid (CAS: 1002339-79-8), it is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...