Compound Q&A

What industries use (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate (CAS: 1000414-38-9)?

Answer

(S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate
(S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate is used in the pharmaceutical industry for the synthesis of chiral intermediates and drug candidates. It is also employed in the sensor industry for the development of gas sensors due to its reactivity with certain gases. Additionally, it has potential applications in the polymer industry as a monomer for the production of functional polymers.

About

English Name (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES COC(=O)CC1COC2=C1C=CC(=C2)O
InChIKey RHMDISFJOKCCAQ-SSDOTTSWSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate (CAS: 1000414-38-9)?

(S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate is a crystalline compound with a molecula...

Compound Q&A

How is (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate (CAS: 1000414-38-9) typically synthesized?

(S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate can be synthesized via a multi-step proce...

Compound Q&A

What precautions should be taken when handling (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate (CAS: 1000414-38-9)?

When handling (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate, it is important to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...