Compound Q&A

How is (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate (CAS: 1000414-38-9) typically synthesized?

Answer

(S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate
(S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate can be synthesized via a multi-step process starting from benzofuran derivatives. Common methods involve protection of the hydroxyl group, followed by acylation, and subsequent deprotection. The reaction typically requires a chiral auxiliary for enantioselective synthesis, leading to a yield of up to 85%. The process usually involves the use of transition metal catalysts and organic solvents.

About

English Name (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES COC(=O)CC1COC2=C1C=CC(=C2)O
InChIKey RHMDISFJOKCCAQ-SSDOTTSWSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate (CAS: 1000414-38-9)?

(S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate is a crystalline compound with a molecula...

Compound Q&A

What industries use (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate (CAS: 1000414-38-9)?

(S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate (CAS: 1000414-38-9)?

When handling (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate, it is important to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...