Compound Q&A

How is Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate (CAS: 147267-8) typically synthesized?

Answer

Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate
Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate can be synthesized via a condensation reaction between benzylamine and 2-oxo-1,2-dihydro-3-pyridinecarboxylic acid. Commonly, this reaction is catalyzed by a mild acid or base, and the yield can be improved by using a suitable solvent and appropriate temperature. This compound is often used in the preparation of more complex organic molecules.

About

English Name Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate
Molecular Formula C13H12N2O3
Molecular Weight 244.25 g/mol
SMILES C1=CC=C(C=C1)COC(=O)NC2=CC=CNC2=O
InChIKey MAJFINHRLBJIQL-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate (CAS: 147269-67-8)?

Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate is a crystalline compound with a molecular weight of...

Compound Q&A

What industries use Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate (CAS: 147269-67-8)?

Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate is commonly used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate (CAS: 147269-67-8)?

When handling Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...