Compound Q&A

What are the physical and chemical properties of Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate (CAS: 147269-67-8)?

Answer

Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate
Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate is a crystalline compound with a molecular weight of approximately 243.27 g/mol. It has a high solubility in organic solvents such as dimethylformamide and methanol but is poorly soluble in water. Chemically, it is relatively stable but can react with strong acids or bases. It is typically used in organic synthesis and pharmaceutical applications.

About

English Name Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate
Molecular Formula C13H12N2O3
Molecular Weight 244.25 g/mol
SMILES C1=CC=C(C=C1)COC(=O)NC2=CC=CNC2=O
InChIKey MAJFINHRLBJIQL-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate (CAS: 147267-8) typically synthesized?

Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate can be synthesized via a condensation reaction betwe...

Compound Q&A

What industries use Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate (CAS: 147269-67-8)?

Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate is commonly used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate (CAS: 147269-67-8)?

When handling Benzyl (2-oxo-1,2-dihydro-3-pyridinyl)carbamate, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...