Compound Q&A

What are the physical and chemical properties of 8-(Trifluoromethyl)quinoline (CAS: 317-57-7)?

Answer

8-(Trifluoromethyl)quinoline
8-(Trifluoromethyl)quinoline (CAS: 317-57-7) is a crystalline solid with a molecular weight of approximately 252.11 g/mol. It has a solubility in water of about 0.015 g/L. Chemically, it is highly reactive and readily forms complexes with various metals. It is soluble in common organic solvents like ethanol and acetone. The compound is known for its low reactivity towards nucleophiles but exhibits higher reactivity towards electrophiles.

About

CAS No 317-57-7
English Name 8-(Trifluoromethyl)quinoline
Molecular Formula C10H6F3N
Molecular Weight 197.16 g/mol
SMILES C1=CC2=C(C(=C1)C(F)(F)F)N=CC=C2
InChIKey AJXUSUNIYLSPER-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is 8-(Trifluoromethyl)quinoline (CAS: 317-57-7) typically synthesized?

8-(Trifluoromethyl)quinoline (CAS: 317-57-7) is typically synthesized through a condensation reactio...

Compound Q&A

What industries use 8-(Trifluoromethyl)quinoline (CAS: 317-57-7)?

8-(Trifluoromethyl)quinoline (CAS: 317-57-7) is used in various industries including pharmaceuticals...

Compound Q&A

What precautions should be taken when handling 8-(Trifluoromethyl)quinoline (CAS: 317-57-7)?

When handling 8-(Trifluoromethyl)quinoline (CAS: 317-57-7), it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...