Compound Q&A

What are the physical and chemical properties of 3'-Deoxyuridine (CAS: 7057-27-4)?

Answer

3'-Deoxyuridine
3'-Deoxyuridine is a white crystalline solid with a molecular weight of approximately 238.22 g/mol. It is poorly soluble in water but soluble in organic solvents like methanol and ethanol. Chemically, it is relatively stable but can undergo hydrolysis under acidic or basic conditions. It does not generally react with common reagents unless under specific conditions.

About

CAS No 7057-27-4
English Name 3'-Deoxyuridine
Molecular Formula C9H12N2O5
Molecular Weight 228.2 g/mol
SMILES C1C(OC(C1O)N2C=CC(=O)NC2=O)CO
InChIKey QOXJRLADYHZRGC-SHYZEUOFSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is 3'-Deoxyuridine (CAS: 7057-27-4) typically synthesized?

3'-Deoxyuridine is typically synthesized through a multi-step process involving the protection of ur...

Compound Q&A

What industries use 3'-Deoxyuridine (CAS: 7057-27-4)?

3'-Deoxyuridine is primarily used in the pharmaceutical industry for the development of antiviral dr...

Compound Q&A

What precautions should be taken when handling 3'-Deoxyuridine (CAS: 7057-27-4)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...