Compound Q&A

What precautions should be taken when handling N,N'-(2-Chloro-1,4-phenylene)bis{4-[(E)-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide} (CAS: 5280-78-4)?

Answer

N,N'-(2-Chloro-1,4-phenylene)bis{4-[(E)-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide}
Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn. Work should be conducted in a fume hood. Spills should be cleaned up carefully using appropriate PPE, and the area should be well-ventilated. Refer to the safety data sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 5280-78-4
English Name N,N'-(2-Chloro-1,4-phenylene)bis{4-[(E)-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide}
Molecular Formula C40H23Cl5N6O4
Molecular Weight 828.93 g/mol
SMILES Clc4cc(ccc4NC(=O)c3cc1ccccc1c(/N=N/c2cc(Cl)ccc2Cl)c3O)NC(=O)c7cc5ccccc5c(/N=N/c6cc(Cl)ccc6Cl)c7O
InChIKey IJBLMBVNVKWXHY-BSLTZQBWSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-(2-Chloro-1,4-phenylene)bis{4-[(E)-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide} (CAS: 5280-78-4)?

This compound is a crystalline solid with a high molecular weight. It has low water solubility but g...

Compound Q&A

How is N,N'-(2-Chloro-1,4-phenylene)bis{4-[(E)-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide} (CAS: 5280-78-4) typically synthesized?

This compound can be synthesized via diazotization and condensation reactions. It involves the diazo...

Compound Q&A

What industries use N,N'-(2-Chloro-1,4-phenylene)bis{4-[(E)-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide} (CAS: 5280-78-4)?

This compound is primarily used in the pharmaceutical industry for its diazo group reactivity. It is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...