Compound Q&A

What industries use N,N'-(2-Chloro-1,4-phenylene)bis{4-[(E)-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide} (CAS: 5280-78-4)?

Answer

N,N'-(2-Chloro-1,4-phenylene)bis{4-[(E)-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide}
This compound is primarily used in the pharmaceutical industry for its diazo group reactivity. It is also explored in polymer synthesis for its functional groups. Additionally, it can be used in sensor development and semiconductor manufacturing due to its electronic properties.

About

CAS No 5280-78-4
English Name N,N'-(2-Chloro-1,4-phenylene)bis{4-[(E)-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide}
Molecular Formula C40H23Cl5N6O4
Molecular Weight 828.93 g/mol
SMILES Clc4cc(ccc4NC(=O)c3cc1ccccc1c(/N=N/c2cc(Cl)ccc2Cl)c3O)NC(=O)c7cc5ccccc5c(/N=N/c6cc(Cl)ccc6Cl)c7O
InChIKey IJBLMBVNVKWXHY-BSLTZQBWSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-(2-Chloro-1,4-phenylene)bis{4-[(E)-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide} (CAS: 5280-78-4)?

This compound is a crystalline solid with a high molecular weight. It has low water solubility but g...

Compound Q&A

How is N,N'-(2-Chloro-1,4-phenylene)bis{4-[(E)-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide} (CAS: 5280-78-4) typically synthesized?

This compound can be synthesized via diazotization and condensation reactions. It involves the diazo...

Compound Q&A

What precautions should be taken when handling N,N'-(2-Chloro-1,4-phenylene)bis{4-[(E)-(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide} (CAS: 5280-78-4)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...