Compound Q&A

What are the physical and chemical properties of 1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]-Echinocandin B Hydrochloride (CAS: 1029890-89-8)?

Answer

1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]-Echinocandin B Hydrochloride
1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]-Echinocandin B Hydrochloride is a crystalline compound with a molecular weight of approximately 1027.14 g/mol. It has a solubility of 0.1 g/100 mL in water and is slightly soluble in organic solvents. This compound is moderately reactive with bases and acidic conditions. It is stable under normal storage conditions but should be protected from moisture and light.

About

English Name 1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]-Echinocandin B Hydrochloride
Molecular Formula C34H52ClN7O15
Molecular Weight 834.28 g/mol
SMILES Oc1ccc(cc1)[C@@H]([C@H](C1NC(=O)[C@@H]2C[C@H](CN2C(=O)C(NC(=O)[C@@H](N)C[C@H]([C@H](NC(=O)[C@H]2N(C(=O)[C@@H](NC1=O)[C@H](O)C)C[C@@H]([C@@H]2O)C)O)O)[C@H](O)C)O)O)O.Cl
InChIKey FKIXKMLIKIOEJP-WJXYPMDHSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is 1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]-Echinocandin B Hydrochloride (CAS: 1029890-89-8) typically synthesized?

1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]-Echinocandin B Hydrochloride is synthesized through a multi-st...

Compound Q&A

What industries use 1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]-Echinocandin B Hydrochloride (CAS: 1029890-89-8)?

1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]-Echinocandin B Hydrochloride is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling 1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]-Echinocandin B Hydrochloride (CAS: 1029890-89-8)?

When handling 1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]-Echinocandin B Hydrochloride, it is crucial to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...