Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate (CAS: 858671-91-7)?

Answer

2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate
When handling 2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate, it is essential to use personal protective equipment such as gloves, goggles, and protective clothing. The compound should be stored in a cool, dry place, and reactions should be carried out in a well-ventilated area or fume hood. In case of spillage, immediately neutralize the spill with an appropriate acid/base and follow proper waste disposal protocols as recommended in the Safety Data Sheet (SDS).

About

English Name 2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate
Molecular Formula C11H20N2O2
Molecular Weight 212.29 g/mol
SMILES CC(C)(C)OC(=O)N1CC2CCC1CN2
InChIKey RBLOMFQUEUBEBG-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate (CAS: 858671-91-7)?

2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate is a colorless liquid with a molecul...

Compound Q&A

How is 2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate (CAS: 858671-91-7) typically synthesized?

2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate can be synthesized through the react...

Compound Q&A

What industries use 2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate (CAS: 858671-91-7)?

2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate finds applications in the pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...