Compound Q&A

What industries use 2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate (CAS: 858671-91-7)?

Answer

2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate
2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate finds applications in the pharmaceutical industry for its use as a precursor in the synthesis of various organic compounds. It is also utilized in the polymer industry for modifying polymer properties and in the semiconductor industry for its role in chemical vapor deposition processes.

About

English Name 2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate
Molecular Formula C11H20N2O2
Molecular Weight 212.29 g/mol
SMILES CC(C)(C)OC(=O)N1CC2CCC1CN2
InChIKey RBLOMFQUEUBEBG-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate (CAS: 858671-91-7)?

2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate is a colorless liquid with a molecul...

Compound Q&A

How is 2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate (CAS: 858671-91-7) typically synthesized?

2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate can be synthesized through the react...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate (CAS: 858671-91-7)?

When handling 2-Methyl-2-propanyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate, it is essential to us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...