Compound Q&A

What industries use (1R,8R)-7,7-Dichloro-11,11-dimethyl-5-oxa-3-thia-4-azatetracyclo[6.2.1.0~1,6~.0~4,6~]undecane 3,3-dioxide (CAS: 139628-16-3)?

Answer

(1R,8R)-7,7-Dichloro-11,11-dimethyl-5-oxa-3-thia-4-azatetracyclo[6.2.1.0~1,6~.0~4,6~]undecane 3,3-dioxide
This compound is primarily used in the pharmaceutical industry for the development of novel drugs due to its unique chemical structure. It may also have applications in the polymer industry for the synthesis of special polymers with specific properties, and in the chemical sensor industry for the development of sensors with enhanced selectivity towards specific analytes.

About

English Name (1R,8R)-7,7-Dichloro-11,11-dimethyl-5-oxa-3-thia-4-azatetracyclo[6.2.1.0~1,6~.0~4,6~]undecane 3,3-dioxide
Molecular Formula C10H13Cl2NO3S
Molecular Weight 298.19 g/mol
SMILES CC1(C2CCC13CS(=O)(=O)N4C3(C2(Cl)Cl)O4)C
InChIKey HAMBQYFZDBYWHU-VUKVJFTISA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,8R)-7,7-Dichloro-11,11-dimethyl-5-oxa-3-thia-4-azatetracyclo[6.2.1.0~1,6~.0~4,6~]undecane 3,3-dioxide (CAS: 139628-16-3)?

The compound is a crystalline solid with a molecular weight of approximately 366.04 g/mol. Its solub...

Compound Q&A

How is (1R,8R)-7,7-Dichloro-11,11-dimethyl-5-oxa-3-thia-4-azatetracyclo[6.2.1.0~1,6~.0~4,6~]undecane 3,3-dioxide (CAS: 139628-16-3) typically synthesized?

The compound is synthesized through a multi-step process that involves organocatalytic reactions, ty...

Compound Q&A

What precautions should be taken when handling (1R,8R)-7,7-Dichloro-11,11-dimethyl-5-oxa-3-thia-4-azatetracyclo[6.2.1.0~1,6~.0~4,6~]undecane 3,3-dioxide (CAS: 139628-16-3)?

Handling this compound requires the use of appropriate personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...