Compound Q&A

What are the physical and chemical properties of (1R,8R)-7,7-Dichloro-11,11-dimethyl-5-oxa-3-thia-4-azatetracyclo[6.2.1.0~1,6~.0~4,6~]undecane 3,3-dioxide (CAS: 139628-16-3)?

Answer

(1R,8R)-7,7-Dichloro-11,11-dimethyl-5-oxa-3-thia-4-azatetracyclo[6.2.1.0~1,6~.0~4,6~]undecane 3,3-dioxide
The compound is a crystalline solid with a molecular weight of approximately 366.04 g/mol. Its solubility in water is low, with limited data available. It exhibits high reactivity towards nucleophiles and can undergo ring-opening reactions. The compound is also susceptible to hydrolysis in the presence of moisture and acidic or basic conditions.

About

English Name (1R,8R)-7,7-Dichloro-11,11-dimethyl-5-oxa-3-thia-4-azatetracyclo[6.2.1.0~1,6~.0~4,6~]undecane 3,3-dioxide
Molecular Formula C10H13Cl2NO3S
Molecular Weight 298.19 g/mol
SMILES CC1(C2CCC13CS(=O)(=O)N4C3(C2(Cl)Cl)O4)C
InChIKey HAMBQYFZDBYWHU-VUKVJFTISA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is (1R,8R)-7,7-Dichloro-11,11-dimethyl-5-oxa-3-thia-4-azatetracyclo[6.2.1.0~1,6~.0~4,6~]undecane 3,3-dioxide (CAS: 139628-16-3) typically synthesized?

The compound is synthesized through a multi-step process that involves organocatalytic reactions, ty...

Compound Q&A

What industries use (1R,8R)-7,7-Dichloro-11,11-dimethyl-5-oxa-3-thia-4-azatetracyclo[6.2.1.0~1,6~.0~4,6~]undecane 3,3-dioxide (CAS: 139628-16-3)?

This compound is primarily used in the pharmaceutical industry for the development of novel drugs du...

Compound Q&A

What precautions should be taken when handling (1R,8R)-7,7-Dichloro-11,11-dimethyl-5-oxa-3-thia-4-azatetracyclo[6.2.1.0~1,6~.0~4,6~]undecane 3,3-dioxide (CAS: 139628-16-3)?

Handling this compound requires the use of appropriate personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...