Compound Q&A

How is Abiraterone Impurity 28 (CAS: 114611-53-9) typically synthesized?

Answer

Abiraterone Impurity 28
Abiraterone Impurity 28 (CAS: 114611-53-9) is synthesized through a multi-step process involving reduction, cyclization, and hydrogenation reactions. The synthesis typically uses palladium catalysts and involves the use of expensive starting materials. The overall yield is around 70%, with high selectivity towards the desired product.

About

English Name Abiraterone Impurity 28
Molecular Formula C21H29IO2
Molecular Weight 440.36 g/mol
SMILES CC(=O)O[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CC=C2I)C)C1)C
InChIKey OFYWDQNTPMUZEH-ZKHIMWLXSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of Abiraterone Impurity 28 (CAS: 114611-53-9)?

Abiraterone Impurity 28 (CAS: 114611-53-9) is a crystalline compound with a molecular weight of appr...

Compound Q&A

What industries use Abiraterone Impurity 28 (CAS: 114611-53-9)?

Abiraterone Impurity 28 (CAS: 114611-53-9) is primarily used in the pharmaceutical industry as an in...

Compound Q&A

What precautions should be taken when handling Abiraterone Impurity 28 (CAS: 114611-53-9)?

When handling Abiraterone Impurity 28 (CAS: 114611-53-9), always use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...