Compound Q&A

What industries use 2,3,5,6-Tetrachloro-4-pyridinamine (CAS: 2176-63-8)?

Answer

2,3,5,6-Tetrachloro-4-pyridinamine
2,3,5,6-Tetrachloro-4-pyridinamine (CAS: 2176-63-8) is used in various industries, including pharmaceuticals, where it serves as a key intermediate in the synthesis of certain drugs. It is also utilized in the production of sensors and some semiconductors due to its chemical reactivity and stability. Additionally, it finds application in polymers and other organic compounds.

About

CAS No 2176-63-8
English Name 2,3,5,6-Tetrachloro-4-pyridinamine
Molecular Formula C5H2Cl4N2
Molecular Weight 231.9 g/mol
SMILES C1(=C(C(=NC(=C1Cl)Cl)Cl)Cl)N
InChIKey CPLQYBDXWJHBST-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrachloro-4-pyridinamine (CAS: 2176-63-8)?

2,3,5,6-Tetrachloro-4-pyridinamine (CAS: 2176-63-8) is a white to off-white crystalline solid with a...

Compound Q&A

How is 2,3,5,6-Tetrachloro-4-pyridinamine (CAS: 2176-63-8) typically synthesized?

2,3,5,6-Tetrachloro-4-pyridinamine (CAS: 2176-63-8) is typically synthesized via the reduction of 2,...

Compound Q&A

What precautions should be taken when handling 2,3,5,6-Tetrachloro-4-pyridinamine (CAS: 2176-63-8)?

Proper handling of 2,3,5,6-Tetrachloro-4-pyridinamine (CAS: 2176-63-8) requires the use of personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...