Compound Q&A

What industries use 5,5'-(9,10-Anthracenediyl)diisophthalic acid (CAS: 422269-95-2)?

Answer

5,5'-(9,10-Anthracenediyl)diisophthalic acid
5,5'-(9,10-Anthracenediyl)diisophthalic acid is primarily used in the polymer industry for the development of high-performance polymers with enhanced optical and electronic properties. It also finds applications in the pharmaceutical sector for the synthesis of specific drug intermediates and in the semiconductor industry for electronic materials.

About

English Name 5,5'-(9,10-Anthracenediyl)diisophthalic acid
Molecular Formula C30H18O8
Molecular Weight 506.47 g/mol
SMILES c1ccc2c(c1)c(c3ccccc3c2c4cc(cc(c4)C(=O)O)C(=O)O)c5cc(cc(c5)C(=O)O)C(=O)O
InChIKey NIFGWZVJZPTKRA-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,5'-(9,10-Anthracenediyl)diisophthalic acid (CAS: 422269-95-2)?

5,5'-(9,10-Anthracenediyl)diisophthalic acid is a crystalline solid with a high molecular weight and...

Compound Q&A

How is 5,5'-(9,10-Anthracenediyl)diisophthalic acid (CAS: 422269-95-2) typically synthesized?

5,5'-(9,10-Anthracenediyl)diisophthalic acid is synthesized via esterification of anthracenedicarbox...

Compound Q&A

What precautions should be taken when handling 5,5'-(9,10-Anthracenediyl)diisophthalic acid (CAS: 422269-95-2)?

When handling 5,5'-(9,10-Anthracenediyl)diisophthalic acid, proper personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...