Compound Q&A

What are the physical and chemical properties of 5,5'-(9,10-Anthracenediyl)diisophthalic acid (CAS: 422269-95-2)?

Answer

5,5'-(9,10-Anthracenediyl)diisophthalic acid
5,5'-(9,10-Anthracenediyl)diisophthalic acid is a crystalline solid with a high molecular weight and good thermal stability. It has a low aqueous solubility but is more soluble in organic solvents. The compound shows moderate reactivity in esterification and amide-forming reactions, making it suitable for polymer synthesis. Its anthracenediyl linkage provides unique optical and electronic properties.

About

English Name 5,5'-(9,10-Anthracenediyl)diisophthalic acid
Molecular Formula C30H18O8
Molecular Weight 506.47 g/mol
SMILES c1ccc2c(c1)c(c3ccccc3c2c4cc(cc(c4)C(=O)O)C(=O)O)c5cc(cc(c5)C(=O)O)C(=O)O
InChIKey NIFGWZVJZPTKRA-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is 5,5'-(9,10-Anthracenediyl)diisophthalic acid (CAS: 422269-95-2) typically synthesized?

5,5'-(9,10-Anthracenediyl)diisophthalic acid is synthesized via esterification of anthracenedicarbox...

Compound Q&A

What industries use 5,5'-(9,10-Anthracenediyl)diisophthalic acid (CAS: 422269-95-2)?

5,5'-(9,10-Anthracenediyl)diisophthalic acid is primarily used in the polymer industry for the devel...

Compound Q&A

What precautions should be taken when handling 5,5'-(9,10-Anthracenediyl)diisophthalic acid (CAS: 422269-95-2)?

When handling 5,5'-(9,10-Anthracenediyl)diisophthalic acid, proper personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...