Compound Q&A

How is 4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline (CAS: 1258947-79-3) typically synthesized?

Answer

4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline
4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline is synthesized through a multi-step process involving the condensation of 1,3-dimethylimidazolium salt with 4,4′-diaminodiphenyl ether. The reaction is catalyzed by a mild acid, such as acetic acid, and proceeds under mild conditions to give a yield of about 70-80%. The reaction is selective and produces the desired product with good purity.

About

English Name 4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline
Molecular Formula C27H21N7
Molecular Weight 443.51 g/mol
SMILES c1cc(ccc1n2ccnc2)N(c3ccc(cc3)n4ccnc4)c5ccc(cc5)n6ccnc6
InChIKey XXDCQSZBEIDWSY-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline (CAS: 1258947-79-3)?

4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline is a crystalline solid with a molecu...

Compound Q&A

What industries use 4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline (CAS: 1258947-79-3)?

4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline (CAS: 1258947-79-3)?

When handling 4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline, safety glasses and gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...