Compound Q&A

What are the physical and chemical properties of 4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline (CAS: 1258947-79-3)?

Answer

4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline
4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline is a crystalline solid with a molecular weight of approximately 428.3 g/mol. It is slightly soluble in water and ethanol. The compound is known for its good stability and low reactivity under normal conditions. It is more reactive towards nucleophiles and bases, making it useful in various synthetic applications.

About

English Name 4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline
Molecular Formula C27H21N7
Molecular Weight 443.51 g/mol
SMILES c1cc(ccc1n2ccnc2)N(c3ccc(cc3)n4ccnc4)c5ccc(cc5)n6ccnc6
InChIKey XXDCQSZBEIDWSY-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is 4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline (CAS: 1258947-79-3) typically synthesized?

4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline is synthesized through a multi-step ...

Compound Q&A

What industries use 4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline (CAS: 1258947-79-3)?

4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline (CAS: 1258947-79-3)?

When handling 4-(1H-Imidazol-1-yl)-N,N-bis[4-(1H-imidazol-1-yl)phenyl]aniline, safety glasses and gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...