Compound Q&A

What industries use 5-Bromo-1-benzothiophene-3-carboxylic acid (CAS: 7312-24-5)?

Answer

5-Bromo-1-benzothiophene-3-carboxylic acid
5-Bromo-1-benzothiophene-3-carboxylic acid is used in the pharmaceutical industry for the synthesis of certain drugs. It is also employed in the polymer industry for the development of functional polymers, and in the semiconductor industry for the production of advanced materials. Additionally, it finds applications in the sensor technology sector due to its unique chemical properties.

About

CAS No 7312-24-5
English Name 5-Bromo-1-benzothiophene-3-carboxylic acid
Molecular Formula C9H5BrO2S
Molecular Weight 257.11 g/mol
SMILES C1=CC2=C(C=C1Br)C(=CS2)C(=O)O
InChIKey DWQBOPASRUUSKR-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-1-benzothiophene-3-carboxylic acid (CAS: 7312-24-5)?

5-Bromo-1-benzothiophene-3-carboxylic acid is a white crystalline solid with a molecular weight of a...

Compound Q&A

How is 5-Bromo-1-benzothiophene-3-carboxylic acid (CAS: 7312-24-5) typically synthesized?

5-Bromo-1-benzothiophene-3-carboxylic acid is commonly synthesized via bromination of 1-benzothiophe...

Compound Q&A

What precautions should be taken when handling 5-Bromo-1-benzothiophene-3-carboxylic acid (CAS: 7312-24-5)?

When handling 5-Bromo-1-benzothiophene-3-carboxylic acid, it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...