Compound Q&A

What precautions should be taken when handling 1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol (CAS: 247123-09-7)?

Answer

1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol
When handling this compound, appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat should be worn. It should be stored in a cool, dry place away from heat and strong oxidizing agents. Spills should be handled using appropriate spill kits and the Material Safety Data Sheet (MSDS) should be consulted for specific guidance. The compound is reactive and should be used in a fume hood to avoid inhalation or skin contact.

About

English Name 1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol
Molecular Formula C50H58O2
Molecular Weight 691.01 g/mol
SMILES CC(C)C1=CC(=C(C(=C1)C(C)C)C2=CC3=CC=CC=C3C(=C2O)C4=C(C(=CC5=CC=CC=C54)C6=C(C=C(C=C6C(C)C)C(C)C)C(C)C)O)C(C)C
InChIKey BCAHCEFAVPAFSH-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol (CAS: 247123-09-7)?

1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol is...

Compound Q&A

How is 1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol (CAS: 247123-09-7) typically synthesized?

The compound is typically synthesized via a multi-step process involving the reaction of 2,4,6-triis...

Compound Q&A

What industries use 1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol (CAS: 247123-09-7)?

This compound is primarily used in the pharmaceutical industry for developing novel drug candidates....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...