Compound Q&A

What are the physical and chemical properties of 1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol (CAS: 247123-09-7)?

Answer

1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol
1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol is a crystalline solid with a molecular weight of approximately 921.4 g/mol. It has a low solubility in water but is soluble in organic solvents like dichloromethane and acetone. Chemically, it is reactive towards acids and bases, and it can undergo substitution reactions. It is stable under normal conditions but should be stored in a cool, dry place away from strong oxidizing agents.

About

English Name 1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol
Molecular Formula C50H58O2
Molecular Weight 691.01 g/mol
SMILES CC(C)C1=CC(=C(C(=C1)C(C)C)C2=CC3=CC=CC=C3C(=C2O)C4=C(C(=CC5=CC=CC=C54)C6=C(C=C(C=C6C(C)C)C(C)C)C(C)C)O)C(C)C
InChIKey BCAHCEFAVPAFSH-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is 1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol (CAS: 247123-09-7) typically synthesized?

The compound is typically synthesized via a multi-step process involving the reaction of 2,4,6-triis...

Compound Q&A

What industries use 1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol (CAS: 247123-09-7)?

This compound is primarily used in the pharmaceutical industry for developing novel drug candidates....

Compound Q&A

What precautions should be taken when handling 1-[2-hydroxy-3-(2,4,6-triisopropylphenyl)-1-naphthyl]-3-(2,4,6-triisopropylphenyl)naphthalen-2-ol (CAS: 247123-09-7)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, safety ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...