Compound Q&A

How should 1,2-(~2~H_4_)Benzenedicarboxylic acid (CAS: 87976-26-9) be stored?

Answer

1,2-(~2~H_4_)Benzenedicarboxylic acid
1,2-(~2~H_4_)Benzenedicarboxylic acid should be stored in a well-ventilated area away from heat sources and direct sunlight. It should be kept in a tightly sealed container to prevent moisture absorption. The storage temperature should be between 10-25°C, and the relative humidity should be kept below 60% to maintain its stable properties.

About

CAS No 87976-26-9
English Name 1,2-(~2~H_4_)Benzenedicarboxylic acid
Molecular Formula C8H2D4O4
Molecular Weight 170.16 g/mol
SMILES c1([2H])c([2H])c([2H])c(c(c1C(=O)O)C(=O)O)[2H]
InChIKey XNGIFLGASWRNHJ-RHQRLBAQSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What is 1,2-(~2~H_4_)Benzenedicarboxylic acid (CAS: 87976-26-9)?

1,2-(~2~H_4_)Benzenedicarboxylic acid (CAS: 87976-26-9) is a chemical compound with the molecular fo...

Compound Q&A

What are the main uses of 1,2-(~2~H_4_)Benzenedicarboxylic acid (CAS: 87976-26-9)?

1,2-(~2~H_4_)Benzenedicarboxylic acid is used in the synthesis of various organic compounds, particu...

Compound Q&A

Is 1,2-(~2~H_4_)Benzenedicarboxylic acid (CAS: 87976-26-9) safe?

1,2-(~2~H_4_)Benzenedicarboxylic acid is generally considered safe for laboratory use when proper pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...