Compound Q&A

What are the main uses of 1,2-(~2~H_4_)Benzenedicarboxylic acid (CAS: 87976-26-9)?

Answer

1,2-(~2~H_4_)Benzenedicarboxylic acid
1,2-(~2~H_4_)Benzenedicarboxylic acid is used in the synthesis of various organic compounds, particularly in the production of polymers. It is also utilized in the pharmaceutical industry as a precursor for drug synthesis and in chemical research for its reactivity with metals and other compounds.

About

CAS No 87976-26-9
English Name 1,2-(~2~H_4_)Benzenedicarboxylic acid
Molecular Formula C8H2D4O4
Molecular Weight 170.15640711199995 g/mol
SMILES c1([2H])c([2H])c([2H])c(c(c1C(=O)O)C(=O)O)[2H]
InChIKey XNGIFLGASWRNHJ-RHQRLBAQSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What is 1,2-(~2~H_4_)Benzenedicarboxylic acid (CAS: 87976-26-9)?

1,2-(~2~H_4_)Benzenedicarboxylic acid (CAS: 87976-26-9) is a chemical compound with the molecular fo...

Compound Q&A

Is 1,2-(~2~H_4_)Benzenedicarboxylic acid (CAS: 87976-26-9) safe?

1,2-(~2~H_4_)Benzenedicarboxylic acid is generally considered safe for laboratory use when proper pr...

Compound Q&A

How should 1,2-(~2~H_4_)Benzenedicarboxylic acid (CAS: 87976-26-9) be stored?

1,2-(~2~H_4_)Benzenedicarboxylic acid should be stored in a well-ventilated area away from heat sour...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...