Compound Q&A

Is Besifloxacin Impurity B (CAS: 101987-89-7) safe?

Answer

Besifloxacin Impurity B
Besifloxacin Impurity B (CAS: 101987-89-7) is generally safe when handled properly. However, it is recommended to use appropriate personal protective equipment such as gloves and safety glasses to minimize potential skin and eye contact. Avoid inhaling dust and ensure good ventilation during handling.

About

English Name Besifloxacin Impurity B
Molecular Formula C13H8ClF2NO3
Molecular Weight 299.66 g/mol
SMILES OC(=O)c1cn(C2CC2)c2c(c1=O)cc(c(c2Cl)F)F
InChIKey ZHFGWIOLVRSZNQ-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What is Besifloxacin Impurity B (CAS: 101987-89-7)?

Besifloxacin Impurity B (CAS: 101987-89-7) is a byproduct of the synthesis process of besifloxacin, ...

Compound Q&A

What are the main uses of Besifloxacin Impurity B (CAS: 101987-89-7)?

Besifloxacin Impurity B (CAS: 101987-89-7) is primarily used as a quality control reference for the ...

Compound Q&A

How should Besifloxacin Impurity B (CAS: 101987-89-7) be stored?

Besifloxacin Impurity B (CAS: 101987-89-7) should be stored in a tightly sealed container to protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...