Compound Q&A

What is Besifloxacin Impurity B (CAS: 101987-89-7)?

Answer

Besifloxacin Impurity B
Besifloxacin Impurity B (CAS: 101987-89-7) is a byproduct of the synthesis process of besifloxacin, a fluoroquinolone antibiotic used in ophthalmic treatments. It is a white to off-white solid with a molecular weight of approximately 456.6 g/mol and a melting point around 235-238°C.

About

English Name Besifloxacin Impurity B
Molecular Formula C13H8ClF2NO3
Molecular Weight 299.66 g/mol
SMILES OC(=O)c1cn(C2CC2)c2c(c1=O)cc(c(c2Cl)F)F
InChIKey ZHFGWIOLVRSZNQ-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What are the main uses of Besifloxacin Impurity B (CAS: 101987-89-7)?

Besifloxacin Impurity B (CAS: 101987-89-7) is primarily used as a quality control reference for the ...

Compound Q&A

Is Besifloxacin Impurity B (CAS: 101987-89-7) safe?

Besifloxacin Impurity B (CAS: 101987-89-7) is generally safe when handled properly. However, it is r...

Compound Q&A

How should Besifloxacin Impurity B (CAS: 101987-89-7) be stored?

Besifloxacin Impurity B (CAS: 101987-89-7) should be stored in a tightly sealed container to protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...